C17H20FN2O5P — CID 21210822
N-[diethoxyphosphoryl-(2-fluorophenyl)methyl]-3-nitroaniline (PubChem CID 21210822) has the molecular formula C17H20FN2O5P and a molecular weight of 382.33 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-(2-fluorophenyl)methyl]-3-nitroaniline.
| Compound Name | N-[diethoxyphosphoryl-(2-fluorophenyl)methyl]-3-nitroaniline |
|---|---|
| PubChem CID | 21210822 |
| Molecular Formula | C17H20FN2O5P |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-[diethoxyphosphoryl-(2-fluorophenyl)methyl]-3-nitroaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1cccc([N+](=O)[O-])c1)c1ccccc1F |
| InChI | InChI=1S/C17H20FN2O5P/c1-3-24-26(23,25-4-2)17(15-10-5-6-11-16(15)18)19-13-8-7-9-14(12-13)20(21)22/h5-12,17,19H,3-4H2,1-2H3 |
| InChIKey | YGKOPEZJPCISFP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|