C17H20F2NO3P — CID 16744084
N-[diethoxyphosphoryl-(3-fluorophenyl)methyl]-2-fluoroaniline (PubChem CID 16744084) has the molecular formula C17H20F2NO3P and a molecular weight of 355.32 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-(3-fluorophenyl)methyl]-2-fluoroaniline.
| Compound Name | N-[diethoxyphosphoryl-(3-fluorophenyl)methyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 16744084 |
| Molecular Formula | C17H20F2NO3P |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[diethoxyphosphoryl-(3-fluorophenyl)methyl]-2-fluoroaniline |
| SMILES | CCOP(=O)(OCC)C(Nc1ccccc1F)c1cccc(F)c1 |
| InChI | InChI=1S/C17H20F2NO3P/c1-3-22-24(21,23-4-2)17(13-8-7-9-14(18)12-13)20-16-11-6-5-10-15(16)19/h5-12,17,20H,3-4H2,1-2H3 |
| InChIKey | RYWQQTYTYVVVGF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|