C20H25FNO4P — CID 24787414
N-[dipropoxyphosphoryl(phenyl)methyl]-3-fluorobenzamide (PubChem CID 24787414) has the molecular formula C20H25FNO4P and a molecular weight of 393.40 g/mol. Its IUPAC name is N-[dipropoxyphosphoryl(phenyl)methyl]-3-fluorobenzamide.
| Compound Name | N-[dipropoxyphosphoryl(phenyl)methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 24787414 |
| Molecular Formula | C20H25FNO4P |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[dipropoxyphosphoryl(phenyl)methyl]-3-fluorobenzamide |
| SMILES | CCCOP(=O)(OCCC)C(NC(=O)c1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C20H25FNO4P/c1-3-13-25-27(24,26-14-4-2)20(16-9-6-5-7-10-16)22-19(23)17-11-8-12-18(21)15-17/h5-12,15,20H,3-4,13-14H2,1-2H3,(H,22,23) |
| InChIKey | UWXNZFRBDKSYPS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|