C18H23N2O4P — CID 14923152
N'-[diethoxyphosphoryl(phenyl)methyl]benzohydrazide (PubChem CID 14923152) has the molecular formula C18H23N2O4P and a molecular weight of 362.37 g/mol. Its IUPAC name is N'-[diethoxyphosphoryl(phenyl)methyl]benzohydrazide.
| Compound Name | N'-[diethoxyphosphoryl(phenyl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 14923152 |
| Molecular Formula | C18H23N2O4P |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N'-[diethoxyphosphoryl(phenyl)methyl]benzohydrazide |
| SMILES | CCOP(=O)(OCC)C(NNC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23N2O4P/c1-3-23-25(22,24-4-2)18(16-13-9-6-10-14-16)20-19-17(21)15-11-7-5-8-12-15/h5-14,18,20H,3-4H2,1-2H3,(H,19,21) |
| InChIKey | DWJSTETZHUWEDT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|