C23H27NO6P2 — CID 23415563
1-diethoxyphosphoryl-N-diphenoxyphosphoryl-1-phenylmethanamine (PubChem CID 23415563) has the molecular formula C23H27NO6P2 and a molecular weight of 475.42 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N-diphenoxyphosphoryl-1-phenylmethanamine.
| Compound Name | 1-diethoxyphosphoryl-N-diphenoxyphosphoryl-1-phenylmethanamine |
|---|---|
| PubChem CID | 23415563 |
| Molecular Formula | C23H27NO6P2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 1-diethoxyphosphoryl-N-diphenoxyphosphoryl-1-phenylmethanamine |
| SMILES | CCOP(=O)(OCC)C(NP(=O)(Oc1ccccc1)Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27NO6P2/c1-3-27-31(25,28-4-2)23(20-14-8-5-9-15-20)24-32(26,29-21-16-10-6-11-17-21)30-22-18-12-7-13-19-22/h5-19,23H,3-4H2,1-2H3,(H,24,26) |
| InChIKey | KWYQLEZXQPRRAO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|