C17H19Cl3NO3P — CID 132583108
2,4,5-trichloro-N-[diethoxyphosphoryl(phenyl)methyl]aniline (PubChem CID 132583108) has the molecular formula C17H19Cl3NO3P and a molecular weight of 422.68 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[diethoxyphosphoryl(phenyl)methyl]aniline.
| Compound Name | 2,4,5-trichloro-N-[diethoxyphosphoryl(phenyl)methyl]aniline |
|---|---|
| PubChem CID | 132583108 |
| Molecular Formula | C17H19Cl3NO3P |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 2,4,5-trichloro-N-[diethoxyphosphoryl(phenyl)methyl]aniline |
| SMILES | CCOP(=O)(OCC)C(Nc1cc(Cl)c(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H19Cl3NO3P/c1-3-23-25(22,24-4-2)17(12-8-6-5-7-9-12)21-16-11-14(19)13(18)10-15(16)20/h5-11,17,21H,3-4H2,1-2H3 |
| InChIKey | YJRGEPSDNLYRGC-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|