C17H21ClNO5PS — CID 3701055
2-chloro-N-[diethoxyphosphoryl(phenyl)methyl]benzenesulfonamide (PubChem CID 3701055) has the molecular formula C17H21ClNO5PS and a molecular weight of 417.85 g/mol. Its IUPAC name is 2-chloro-N-[diethoxyphosphoryl(phenyl)methyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[diethoxyphosphoryl(phenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3701055 |
| Molecular Formula | C17H21ClNO5PS |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 2-chloro-N-[diethoxyphosphoryl(phenyl)methyl]benzenesulfonamide |
| SMILES | CCOP(=O)(OCC)C(NS(=O)(=O)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H21ClNO5PS/c1-3-23-25(20,24-4-2)17(14-10-6-5-7-11-14)19-26(21,22)16-13-9-8-12-15(16)18/h5-13,17,19H,3-4H2,1-2H3 |
| InChIKey | FGUFOAZBFLSIDD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|