C19H25N2O6PS — CID 74225952
N-[4-[[diethoxyphosphoryl(phenyl)methyl]sulfamoyl]phenyl]acetamide (PubChem CID 74225952) has the molecular formula C19H25N2O6PS and a molecular weight of 440.46 g/mol. Its IUPAC name is N-[4-[[diethoxyphosphoryl(phenyl)methyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[diethoxyphosphoryl(phenyl)methyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 74225952 |
| Molecular Formula | C19H25N2O6PS |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-[4-[[diethoxyphosphoryl(phenyl)methyl]sulfamoyl]phenyl]acetamide |
| SMILES | CCOP(=O)(OCC)C(NS(=O)(=O)c1ccc(NC(C)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H25N2O6PS/c1-4-26-28(23,27-5-2)19(16-9-7-6-8-10-16)21-29(24,25)18-13-11-17(12-14-18)20-15(3)22/h6-14,19,21H,4-5H2,1-3H3,(H,20,22) |
| InChIKey | IAAYNGMYUBIXKS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|