C18H24NO4PS — CID 85216866
N-[diethoxyphosphoryl(phenyl)methyl]-4-methylbenzenesulfinamide (PubChem CID 85216866) has the molecular formula C18H24NO4PS and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[diethoxyphosphoryl(phenyl)methyl]-4-methylbenzenesulfinamide.
| Compound Name | N-[diethoxyphosphoryl(phenyl)methyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 85216866 |
| Molecular Formula | C18H24NO4PS |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[diethoxyphosphoryl(phenyl)methyl]-4-methylbenzenesulfinamide |
| SMILES | CCOP(=O)(OCC)C(NS(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H24NO4PS/c1-4-22-24(20,23-5-2)18(16-9-7-6-8-10-16)19-25(21)17-13-11-15(3)12-14-17/h6-14,18-19H,4-5H2,1-3H3 |
| InChIKey | CGKLHXBLKPCVKA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|