C17H22NO4PS — CID 10992203
(S)-N-[(1R)-2-dimethoxyphosphoryl-1-phenylethyl]-4-methylbenzenesulfinamide (PubChem CID 10992203) has the molecular formula C17H22NO4PS and a molecular weight of 367.41 g/mol. Its IUPAC name is (S)-N-[(1R)-2-dimethoxyphosphoryl-1-phenylethyl]-4-methylbenzenesulfinamide.
| Compound Name | (S)-N-[(1R)-2-dimethoxyphosphoryl-1-phenylethyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 10992203 |
| Molecular Formula | C17H22NO4PS |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (S)-N-[(1R)-2-dimethoxyphosphoryl-1-phenylethyl]-4-methylbenzenesulfinamide |
| SMILES | COP(=O)(C[C@H](N[S@@](=O)c1ccc(C)cc1)c1ccccc1)OC |
| InChI | InChI=1S/C17H22NO4PS/c1-14-9-11-16(12-10-14)24(20)18-17(13-23(19,21-2)22-3)15-7-5-4-6-8-15/h4-12,17-18H,13H2,1-3H3/t17-,24-/m0/s1 |
| InChIKey | QVINASSNVMMMKI-XDHUDOTRSA-N |
| XLogP | 3.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|