C12H20NO5PS — CID 11067199
(S)-N-[(1R,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]-4-methylbenzenesulfinamide (PubChem CID 11067199) has the molecular formula C12H20NO5PS and a molecular weight of 321.34 g/mol. Its IUPAC name is (S)-N-[(1R,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]-4-methylbenzenesulfinamide.
| Compound Name | (S)-N-[(1R,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 11067199 |
| Molecular Formula | C12H20NO5PS |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (S)-N-[(1R,2S)-1-dimethoxyphosphoryl-2-hydroxypropyl]-4-methylbenzenesulfinamide |
| SMILES | COP(=O)(OC)[C@@H](N[S@@](=O)c1ccc(C)cc1)[C@H](C)O |
| InChI | InChI=1S/C12H20NO5PS/c1-9-5-7-11(8-6-9)20(16)13-12(10(2)14)19(15,17-3)18-4/h5-8,10,12-14H,1-4H3/t10-,12+,20-/m0/s1 |
| InChIKey | VZGHLWZCHWEUPB-PCIORBNZSA-N |
| XLogP | 1.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|