C12H19O4P — CID 72715863
(1R,2R)-1-dimethoxyphosphoryl-2-(4-methylphenyl)propan-1-ol (PubChem CID 72715863) has the molecular formula C12H19O4P and a molecular weight of 258.25 g/mol. Its IUPAC name is (1R,2R)-1-dimethoxyphosphoryl-2-(4-methylphenyl)propan-1-ol.
| Compound Name | (1R,2R)-1-dimethoxyphosphoryl-2-(4-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 72715863 |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (1R,2R)-1-dimethoxyphosphoryl-2-(4-methylphenyl)propan-1-ol |
| SMILES | COP(=O)(OC)[C@@H](O)[C@H](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H19O4P/c1-9-5-7-11(8-6-9)10(2)12(13)17(14,15-3)16-4/h5-8,10,12-13H,1-4H3/t10-,12-/m1/s1 |
| InChIKey | YZVCEVMUURUUAF-ZYHUDNBSSA-N |
| XLogP | 2.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|