C13H22NO4P — CID 101084250
(1R,2S)-2-amino-1-diethoxyphosphoryl-2-(4-methylphenyl)ethanol (PubChem CID 101084250) has the molecular formula C13H22NO4P and a molecular weight of 287.30 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-diethoxyphosphoryl-2-(4-methylphenyl)ethanol.
| Compound Name | (1R,2S)-2-amino-1-diethoxyphosphoryl-2-(4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 101084250 |
| Molecular Formula | C13H22NO4P |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (1R,2S)-2-amino-1-diethoxyphosphoryl-2-(4-methylphenyl)ethanol |
| SMILES | CCOP(=O)(OCC)[C@@H](O)[C@@H](N)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H22NO4P/c1-4-17-19(16,18-5-2)13(15)12(14)11-8-6-10(3)7-9-11/h6-9,12-13,15H,4-5,14H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | IRYJCSPXUNJKNN-QWHCGFSZSA-N |
| XLogP | 2.58 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|