C15H23N2O8P — CID 23420187
ethyl N-[(1R,2R)-2-diethoxyphosphoryl-2-hydroxy-1-(4-nitrophenyl)ethyl]carbamate (PubChem CID 23420187) has the molecular formula C15H23N2O8P and a molecular weight of 390.33 g/mol. Its IUPAC name is ethyl N-[(1R,2R)-2-diethoxyphosphoryl-2-hydroxy-1-(4-nitrophenyl)ethyl]carbamate.
| Compound Name | ethyl N-[(1R,2R)-2-diethoxyphosphoryl-2-hydroxy-1-(4-nitrophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 23420187 |
| Molecular Formula | C15H23N2O8P |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | ethyl N-[(1R,2R)-2-diethoxyphosphoryl-2-hydroxy-1-(4-nitrophenyl)ethyl]carbamate |
| SMILES | CCOC(=O)N[C@H](c1ccc([N+](=O)[O-])cc1)[C@H](O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H23N2O8P/c1-4-23-15(19)16-13(11-7-9-12(10-8-11)17(20)21)14(18)26(22,24-5-2)25-6-3/h7-10,13-14,18H,4-6H2,1-3H3,(H,16,19)/t13-,14-/m1/s1 |
| InChIKey | JHZMQHAOMFVGGA-ZIAGYGMSSA-N |
| XLogP | 2.97 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|