C19H23N2O7P — CID 101262306
benzyl N-[(R)-diethoxyphosphoryl-(4-nitrophenyl)methyl]carbamate (PubChem CID 101262306) has the molecular formula C19H23N2O7P and a molecular weight of 422.37 g/mol. Its IUPAC name is benzyl N-[(R)-diethoxyphosphoryl-(4-nitrophenyl)methyl]carbamate.
| Compound Name | benzyl N-[(R)-diethoxyphosphoryl-(4-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 101262306 |
| Molecular Formula | C19H23N2O7P |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | benzyl N-[(R)-diethoxyphosphoryl-(4-nitrophenyl)methyl]carbamate |
| SMILES | CCOP(=O)(OCC)[C@@H](NC(=O)OCc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H23N2O7P/c1-3-27-29(25,28-4-2)18(16-10-12-17(13-11-16)21(23)24)20-19(22)26-14-15-8-6-5-7-9-15/h5-13,18H,3-4,14H2,1-2H3,(H,20,22)/t18-/m1/s1 |
| InChIKey | NVSZGKASFJQQGZ-GOSISDBHSA-N |
| XLogP | 4.79 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|