C20H26NO6P — CID 23420217
benzyl N-[diethoxyphosphoryl-(3-methoxyphenyl)methyl]carbamate (PubChem CID 23420217) has the molecular formula C20H26NO6P and a molecular weight of 407.40 g/mol. Its IUPAC name is benzyl N-[diethoxyphosphoryl-(3-methoxyphenyl)methyl]carbamate.
| Compound Name | benzyl N-[diethoxyphosphoryl-(3-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 23420217 |
| Molecular Formula | C20H26NO6P |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | benzyl N-[diethoxyphosphoryl-(3-methoxyphenyl)methyl]carbamate |
| SMILES | CCOP(=O)(OCC)C(NC(=O)OCc1ccccc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H26NO6P/c1-4-26-28(23,27-5-2)19(17-12-9-13-18(14-17)24-3)21-20(22)25-15-16-10-7-6-8-11-16/h6-14,19H,4-5,15H2,1-3H3,(H,21,22) |
| InChIKey | NOYFIANDQODMGS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|