C17H20NO4P — CID 134104684
benzyl N-[[methoxy(methyl)phosphoryl]-phenylmethyl]carbamate (PubChem CID 134104684) has the molecular formula C17H20NO4P and a molecular weight of 333.32 g/mol. Its IUPAC name is benzyl N-[[methoxy(methyl)phosphoryl]-phenylmethyl]carbamate.
| Compound Name | benzyl N-[[methoxy(methyl)phosphoryl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 134104684 |
| Molecular Formula | C17H20NO4P |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | benzyl N-[[methoxy(methyl)phosphoryl]-phenylmethyl]carbamate |
| SMILES | COP(C)(=O)C(NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20NO4P/c1-21-23(2,20)16(15-11-7-4-8-12-15)18-17(19)22-13-14-9-5-3-6-10-14/h3-12,16H,13H2,1-2H3,(H,18,19) |
| InChIKey | FNOBATASIMRFIJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|