C37H37N2O4P — CID 11975938
benzyl N-[[methoxy-[1-(tritylamino)ethyl]phosphoryl]-phenylmethyl]carbamate (PubChem CID 11975938) has the molecular formula C37H37N2O4P and a molecular weight of 604.69 g/mol. Its IUPAC name is benzyl N-[[methoxy-[1-(tritylamino)ethyl]phosphoryl]-phenylmethyl]carbamate.
| Compound Name | benzyl N-[[methoxy-[1-(tritylamino)ethyl]phosphoryl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 11975938 |
| Molecular Formula | C37H37N2O4P |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | benzyl N-[[methoxy-[1-(tritylamino)ethyl]phosphoryl]-phenylmethyl]carbamate |
| SMILES | COP(=O)(C(C)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H37N2O4P/c1-29(39-37(32-22-12-5-13-23-32,33-24-14-6-15-25-33)34-26-16-7-17-27-34)44(41,42-2)35(31-20-10-4-11-21-31)38-36(40)43-28-30-18-8-3-9-19-30/h3-27,29,35,39H,28H2,1-2H3,(H,38,40) |
| InChIKey | FTUVKKCNYFYEQJ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|