C30H27NO4 — CID 73441193
methyl 2,2,3-triphenyl-3-(phenylmethoxycarbonylamino)propanoate (PubChem CID 73441193) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is methyl 2,2,3-triphenyl-3-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | methyl 2,2,3-triphenyl-3-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 73441193 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | methyl 2,2,3-triphenyl-3-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)C(c1ccccc1)(c1ccccc1)C(NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H27NO4/c1-34-28(32)30(25-18-10-4-11-19-25,26-20-12-5-13-21-26)27(24-16-8-3-9-17-24)31-29(33)35-22-23-14-6-2-7-15-23/h2-21,27H,22H2,1H3,(H,31,33) |
| InChIKey | JETXMMSSAPEVQF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |