C16H14Cl3NO3 — CID 1101103
benzyl N-[(1S)-2,2,2-trichloro-1-phenoxyethyl]carbamate (PubChem CID 1101103) has the molecular formula C16H14Cl3NO3 and a molecular weight of 374.65 g/mol. Its IUPAC name is benzyl N-[(1S)-2,2,2-trichloro-1-phenoxyethyl]carbamate.
| Compound Name | benzyl N-[(1S)-2,2,2-trichloro-1-phenoxyethyl]carbamate |
|---|---|
| PubChem CID | 1101103 |
| Molecular Formula | C16H14Cl3NO3 |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | benzyl N-[(1S)-2,2,2-trichloro-1-phenoxyethyl]carbamate |
| SMILES | O=C(N[C@@H](Oc1ccccc1)C(Cl)(Cl)Cl)OCc1ccccc1 |
| InChI | InChI=1S/C16H14Cl3NO3/c17-16(18,19)14(23-13-9-5-2-6-10-13)20-15(21)22-11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | YQVXJRDLWYHZJB-AWEZNQCLSA-N |
| XLogP | 4.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|