C17H18ClNO4 — CID 67105426
benzyl N-[(1R)-1-(4-chlorophenoxy)-1-hydroxypropan-2-yl]carbamate (PubChem CID 67105426) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is benzyl N-[(1R)-1-(4-chlorophenoxy)-1-hydroxypropan-2-yl]carbamate.
| Compound Name | benzyl N-[(1R)-1-(4-chlorophenoxy)-1-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 67105426 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | benzyl N-[(1R)-1-(4-chlorophenoxy)-1-hydroxypropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OCc1ccccc1)[C@H](O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClNO4/c1-12(16(20)23-15-9-7-14(18)8-10-15)19-17(21)22-11-13-5-3-2-4-6-13/h2-10,12,16,20H,11H2,1H3,(H,19,21)/t12?,16-/m1/s1 |
| InChIKey | SQLHRXNTPVPELG-PVQCJRHBSA-N |
| XLogP | 3.35 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|