C24H22ClNO4 — CID 3916130
(4-chlorophenyl)methyl 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 3916130) has the molecular formula C24H22ClNO4 and a molecular weight of 423.90 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (4-chlorophenyl)methyl 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 3916130 |
| Molecular Formula | C24H22ClNO4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (4-chlorophenyl)methyl 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)OCc1ccc(Cl)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H22ClNO4/c25-21-13-11-20(12-14-21)16-29-23(27)22(15-18-7-3-1-4-8-18)26-24(28)30-17-19-9-5-2-6-10-19/h1-14,22H,15-17H2,(H,26,28) |
| InChIKey | GVWPNEYBJPCHOH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |