C24H23ClN2O4 — CID 141301976
benzyl 3-(4-amino-3-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 141301976) has the molecular formula C24H23ClN2O4 and a molecular weight of 438.91 g/mol. Its IUPAC name is benzyl 3-(4-amino-3-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | benzyl 3-(4-amino-3-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 141301976 |
| Molecular Formula | C24H23ClN2O4 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | benzyl 3-(4-amino-3-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | Nc1ccc(CC(NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H23ClN2O4/c25-20-13-19(11-12-21(20)26)14-22(23(28)30-15-17-7-3-1-4-8-17)27-24(29)31-16-18-9-5-2-6-10-18/h1-13,22H,14-16,26H2,(H,27,29) |
| InChIKey | NGCLXOSOKJULFL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|