C17H15BrClNO4 — CID 103923172
3-(3-bromo-4-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 103923172) has the molecular formula C17H15BrClNO4 and a molecular weight of 412.67 g/mol. Its IUPAC name is 3-(3-bromo-4-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(3-bromo-4-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 103923172 |
| Molecular Formula | C17H15BrClNO4 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 3-(3-bromo-4-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1ccc(Cl)c(Br)c1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C17H15BrClNO4/c18-13-8-12(6-7-14(13)19)9-15(16(21)22)20-17(23)24-10-11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,20,23)(H,21,22) |
| InChIKey | LQLPIOWMDDAVKD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |