C24H23NO6 — CID 121282452
3-(4-hydroxy-3-phenylmethoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 121282452) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is 3-(4-hydroxy-3-phenylmethoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(4-hydroxy-3-phenylmethoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 121282452 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 3-(4-hydroxy-3-phenylmethoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1ccc(O)c(OCc2ccccc2)c1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C24H23NO6/c26-21-12-11-19(14-22(21)30-15-17-7-3-1-4-8-17)13-20(23(27)28)25-24(29)31-16-18-9-5-2-6-10-18/h1-12,14,20,26H,13,15-16H2,(H,25,29)(H,27,28) |
| InChIKey | QSIVVAFZZIWSET-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |