C21H25NO5 — CID 139790262
(2S)-3-(3-butyl-4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 139790262) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (2S)-3-(3-butyl-4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-(3-butyl-4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 139790262 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (2S)-3-(3-butyl-4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CCCCc1cc(C[C@H](NC(=O)OCc2ccccc2)C(=O)O)ccc1O |
| InChI | InChI=1S/C21H25NO5/c1-2-3-9-17-12-16(10-11-19(17)23)13-18(20(24)25)22-21(26)27-14-15-7-5-4-6-8-15/h4-8,10-12,18,23H,2-3,9,13-14H2,1H3,(H,22,26)(H,24,25)/t18-/m0/s1 |
| InChIKey | MVWLBPOYOATXCR-SFHVURJKSA-N |
| XLogP | 3.66 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |