C18H20N2O5 — CID 68910907
(2S)-3-(3-amino-4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 68910907) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is (2S)-3-(3-amino-4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-(3-amino-4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 68910907 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2S)-3-(3-amino-4-methoxyphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | COc1ccc(C[C@H](NC(=O)OCc2ccccc2)C(=O)O)cc1N |
| InChI | InChI=1S/C18H20N2O5/c1-24-16-8-7-13(9-14(16)19)10-15(17(21)22)20-18(23)25-11-12-5-3-2-4-6-12/h2-9,15H,10-11,19H2,1H3,(H,20,23)(H,21,22)/t15-/m0/s1 |
| InChIKey | BXLFMMQFJUCCEH-HNNXBMFYSA-N |
| XLogP | 2.20 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|