C17H15ClINO4 — CID 156692064
3-(3-chloro-5-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 156692064) has the molecular formula C17H15ClINO4 and a molecular weight of 459.67 g/mol. Its IUPAC name is 3-(3-chloro-5-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(3-chloro-5-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 156692064 |
| Molecular Formula | C17H15ClINO4 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 458.97 |
| IUPAC Name | 3-(3-chloro-5-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1cc(Cl)cc(I)c1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C17H15ClINO4/c18-13-6-12(7-14(19)9-13)8-15(16(21)22)20-17(23)24-10-11-4-2-1-3-5-11/h1-7,9,15H,8,10H2,(H,20,23)(H,21,22) |
| InChIKey | SZXFHWCQUHTBDW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|