C19H19ClINO3 — CID 126591111
benzyl (2R)-3-(4-chlorophenyl)-2-[[(2R)-2-iodopropanoyl]amino]propanoate (PubChem CID 126591111) has the molecular formula C19H19ClINO3 and a molecular weight of 471.72 g/mol. Its IUPAC name is benzyl (2R)-3-(4-chlorophenyl)-2-[[(2R)-2-iodopropanoyl]amino]propanoate.
| Compound Name | benzyl (2R)-3-(4-chlorophenyl)-2-[[(2R)-2-iodopropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 126591111 |
| Molecular Formula | C19H19ClINO3 |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | benzyl (2R)-3-(4-chlorophenyl)-2-[[(2R)-2-iodopropanoyl]amino]propanoate |
| SMILES | C[C@@H](I)C(=O)N[C@H](Cc1ccc(Cl)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19ClINO3/c1-13(21)18(23)22-17(11-14-7-9-16(20)10-8-14)19(24)25-12-15-5-3-2-4-6-15/h2-10,13,17H,11-12H2,1H3,(H,22,23)/t13-,17-/m1/s1 |
| InChIKey | OWACGMWEFKKWQV-CXAGYDPISA-N |
| XLogP | 3.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|