C29H33N3O4 — CID 144576469
benzyl (2S)-2-[2-[[(2S)-2-amino-4-phenylbutanoyl]amino]propanoylamino]-3-phenylpropanoate (PubChem CID 144576469) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is benzyl (2S)-2-[2-[[(2S)-2-amino-4-phenylbutanoyl]amino]propanoylamino]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[2-[[(2S)-2-amino-4-phenylbutanoyl]amino]propanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 144576469 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | benzyl (2S)-2-[2-[[(2S)-2-amino-4-phenylbutanoyl]amino]propanoylamino]-3-phenylpropanoate |
| SMILES | CC(NC(=O)[C@@H](N)CCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H33N3O4/c1-21(31-28(34)25(30)18-17-22-11-5-2-6-12-22)27(33)32-26(19-23-13-7-3-8-14-23)29(35)36-20-24-15-9-4-10-16-24/h2-16,21,25-26H,17-20,30H2,1H3,(H,31,34)(H,32,33)/t21?,25-,26-/m0/s1 |
| InChIKey | NSBNZFGKFPFOHX-RMFXBNNXSA-N |
| XLogP | 2.92 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |