C17H18ClNO3 — CID 67105648
benzyl N-[1-(4-chlorophenyl)-1-hydroxypropan-2-yl]carbamate (PubChem CID 67105648) has the molecular formula C17H18ClNO3 and a molecular weight of 319.79 g/mol. Its IUPAC name is benzyl N-[1-(4-chlorophenyl)-1-hydroxypropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(4-chlorophenyl)-1-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 67105648 |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | benzyl N-[1-(4-chlorophenyl)-1-hydroxypropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OCc1ccccc1)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClNO3/c1-12(16(20)14-7-9-15(18)10-8-14)19-17(21)22-11-13-5-3-2-4-6-13/h2-10,12,16,20H,11H2,1H3,(H,19,21) |
| InChIKey | HTJKRRGRHBOLHH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |