C17H17NO5 — CID 101062090
(2S,3S)-3-hydroxy-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 101062090) has the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S,3S)-3-hydroxy-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 101062090 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (2S,3S)-3-hydroxy-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(N[C@H](C(=O)O)[C@@H](O)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C17H17NO5/c19-15(13-9-5-2-6-10-13)14(16(20)21)18-17(22)23-11-12-7-3-1-4-8-12/h1-10,14-15,19H,11H2,(H,18,22)(H,20,21)/t14-,15-/m0/s1 |
| InChIKey | SYNFYDJGTLTEFE-GJZGRUSLSA-N |
| XLogP | 2.10 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |