C18H19NO4 — CID 134974281
benzyl N-[(1S,2R)-1-hydroxy-3-oxo-1-phenylbutan-2-yl]carbamate (PubChem CID 134974281) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is benzyl N-[(1S,2R)-1-hydroxy-3-oxo-1-phenylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[(1S,2R)-1-hydroxy-3-oxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 134974281 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | benzyl N-[(1S,2R)-1-hydroxy-3-oxo-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(=O)[C@H](NC(=O)OCc1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO4/c1-13(20)16(17(21)15-10-6-3-7-11-15)19-18(22)23-12-14-8-4-2-5-9-14/h2-11,16-17,21H,12H2,1H3,(H,19,22)/t16-,17-/m0/s1 |
| InChIKey | INEAAEYCSQCMLV-IRXDYDNUSA-N |
| XLogP | 2.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |