C21H28N2O5 — CID 57062651
benzyl N-[(1S,2S)-3-[bis(1-hydroxyethyl)amino]-1-hydroxy-1-phenylpropan-2-yl]carbamate (PubChem CID 57062651) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-3-[bis(1-hydroxyethyl)amino]-1-hydroxy-1-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(1S,2S)-3-[bis(1-hydroxyethyl)amino]-1-hydroxy-1-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 57062651 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | benzyl N-[(1S,2S)-3-[bis(1-hydroxyethyl)amino]-1-hydroxy-1-phenylpropan-2-yl]carbamate |
| SMILES | CC(O)N(C[C@H](NC(=O)OCc1ccccc1)[C@@H](O)c1ccccc1)C(C)O |
| InChI | InChI=1S/C21H28N2O5/c1-15(24)23(16(2)25)13-19(20(26)18-11-7-4-8-12-18)22-21(27)28-14-17-9-5-3-6-10-17/h3-12,15-16,19-20,24-26H,13-14H2,1-2H3,(H,22,27)/t15?,16?,19-,20-/m0/s1 |
| InChIKey | XFLPYCNINDVCKN-PNGKTBNWSA-N |
| XLogP | 1.99 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|