C27H31NO4 — CID 58416941
benzyl N-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methyl-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 58416941) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is benzyl N-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methyl-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methyl-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58416941 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | benzyl N-[(2R,3S,4S,5R)-3,4-dihydroxy-5-methyl-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | C[C@H](Cc1ccccc1)[C@H](O)[C@@H](O)[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H31NO4/c1-20(17-21-11-5-2-6-12-21)25(29)26(30)24(18-22-13-7-3-8-14-22)28-27(31)32-19-23-15-9-4-10-16-23/h2-16,20,24-26,29-30H,17-19H2,1H3,(H,28,31)/t20-,24-,25+,26+/m1/s1 |
| InChIKey | SEBAZTZGGBFBFE-ZDULRJDPSA-N |
| XLogP | 4.12 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |