C20H23NO3 — CID 10087705
benzyl N-[(2S,3S)-3-hydroxy-1-phenylhex-5-en-2-yl]carbamate (PubChem CID 10087705) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-3-hydroxy-1-phenylhex-5-en-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-3-hydroxy-1-phenylhex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 10087705 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | benzyl N-[(2S,3S)-3-hydroxy-1-phenylhex-5-en-2-yl]carbamate |
| SMILES | C=CC[C@H](O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO3/c1-2-9-19(22)18(14-16-10-5-3-6-11-16)21-20(23)24-15-17-12-7-4-8-13-17/h2-8,10-13,18-19,22H,1,9,14-15H2,(H,21,23)/t18-,19-/m0/s1 |
| InChIKey | AUVMAGUEDLCRKO-OALUTQOASA-N |
| XLogP | 3.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|