C38H44N2O10 — CID 10676108
benzyl N-[(2R,3S,4S,5R)-1,6-bis(3,5-dimethoxyphenyl)-3,4-dihydroxy-5-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate (PubChem CID 10676108) has the molecular formula C38H44N2O10 and a molecular weight of 688.77 g/mol. Its IUPAC name is benzyl N-[(2R,3S,4S,5R)-1,6-bis(3,5-dimethoxyphenyl)-3,4-dihydroxy-5-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R,3S,4S,5R)-1,6-bis(3,5-dimethoxyphenyl)-3,4-dihydroxy-5-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 10676108 |
| Molecular Formula | C38H44N2O10 |
| Molecular Weight | 688.77 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | benzyl N-[(2R,3S,4S,5R)-1,6-bis(3,5-dimethoxyphenyl)-3,4-dihydroxy-5-(phenylmethoxycarbonylamino)hexan-2-yl]carbamate |
| SMILES | COc1cc(C[C@@H](NC(=O)OCc2ccccc2)[C@H](O)[C@@H](O)[C@@H](Cc2cc(OC)cc(OC)c2)NC(=O)OCc2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C38H44N2O10/c1-45-29-15-27(16-30(21-29)46-2)19-33(39-37(43)49-23-25-11-7-5-8-12-25)35(41)36(42)34(20-28-17-31(47-3)22-32(18-28)48-4)40-38(44)50-24-26-13-9-6-10-14-26/h5-18,21-22,33-36,41-42H,19-20,23-24H2,1-4H3,(H,39,43)(H,40,44)/t33-,34-,35+,36+/m1/s1 |
| InChIKey | KHTXTDWQYGBFEX-NWJWHWDBSA-N |
| XLogP | 4.82 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.77 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |