C13H17NO5 — CID 56634953
methyl (2R,3S)-2-hydroxy-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 56634953) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl (2R,3S)-2-hydroxy-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2R,3S)-2-hydroxy-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 56634953 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | methyl (2R,3S)-2-hydroxy-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)[C@H](O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO5/c1-9(11(15)12(16)18-2)14-13(17)19-8-10-6-4-3-5-7-10/h3-7,9,11,15H,8H2,1-2H3,(H,14,17)/t9-,11+/m0/s1 |
| InChIKey | TYWVFLIFCCOGEG-GXSJLCMTSA-N |
| XLogP | 0.84 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |