C16H21NO5 — CID 10804650
methyl (4R,5S)-4-hydroxy-2-methylidene-5-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 10804650) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl (4R,5S)-4-hydroxy-2-methylidene-5-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (4R,5S)-4-hydroxy-2-methylidene-5-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 10804650 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | methyl (4R,5S)-4-hydroxy-2-methylidene-5-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | C=C(C[C@@H](O)[C@H](C)NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C16H21NO5/c1-11(15(19)21-3)9-14(18)12(2)17-16(20)22-10-13-7-5-4-6-8-13/h4-8,12,14,18H,1,9-10H2,2-3H3,(H,17,20)/t12-,14+/m0/s1 |
| InChIKey | LSNBSKDLTDWJCU-GXTWGEPZSA-N |
| XLogP | 1.78 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|