C21H37NO4Si — CID 123232862
benzyl N-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamate (PubChem CID 123232862) has the molecular formula C21H37NO4Si and a molecular weight of 395.62 g/mol. Its IUPAC name is benzyl N-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123232862 |
| Molecular Formula | C21H37NO4Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | benzyl N-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamate |
| SMILES | CC(C)[Si](OC[C@H](O)[C@@H](C)NC(=O)OCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H37NO4Si/c1-15(2)27(16(3)4,17(5)6)26-14-20(23)18(7)22-21(24)25-13-19-11-9-8-10-12-19/h8-12,15-18,20,23H,13-14H2,1-7H3,(H,22,24)/t18-,20+/m1/s1 |
| InChIKey | QCMFNZCTHQYABJ-QUCCMNQESA-N |
| XLogP | 4.85 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|