C19H27NO5 — CID 10760235
methyl (4R,5S)-4-hydroxy-7-methyl-2-methylidene-5-(phenylmethoxycarbonylamino)octanoate (PubChem CID 10760235) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl (4R,5S)-4-hydroxy-7-methyl-2-methylidene-5-(phenylmethoxycarbonylamino)octanoate.
| Compound Name | methyl (4R,5S)-4-hydroxy-7-methyl-2-methylidene-5-(phenylmethoxycarbonylamino)octanoate |
|---|---|
| PubChem CID | 10760235 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | methyl (4R,5S)-4-hydroxy-7-methyl-2-methylidene-5-(phenylmethoxycarbonylamino)octanoate |
| SMILES | C=C(C[C@@H](O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C19H27NO5/c1-13(2)10-16(17(21)11-14(3)18(22)24-4)20-19(23)25-12-15-8-6-5-7-9-15/h5-9,13,16-17,21H,3,10-12H2,1-2,4H3,(H,20,23)/t16-,17+/m0/s1 |
| InChIKey | VKHROIZPIUYANP-DLBZAZTESA-N |
| XLogP | 2.81 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|