C22H36N2O3 — CID 22879556
benzyl N-[(3S)-1-[cyclohexyl(methyl)amino]-2-hydroxy-5-methylhexan-3-yl]carbamate (PubChem CID 22879556) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is benzyl N-[(3S)-1-[cyclohexyl(methyl)amino]-2-hydroxy-5-methylhexan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-1-[cyclohexyl(methyl)amino]-2-hydroxy-5-methylhexan-3-yl]carbamate |
|---|---|
| PubChem CID | 22879556 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | benzyl N-[(3S)-1-[cyclohexyl(methyl)amino]-2-hydroxy-5-methylhexan-3-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(O)CN(C)C1CCCCC1 |
| InChI | InChI=1S/C22H36N2O3/c1-17(2)14-20(21(25)15-24(3)19-12-8-5-9-13-19)23-22(26)27-16-18-10-6-4-7-11-18/h4,6-7,10-11,17,19-21,25H,5,8-9,12-16H2,1-3H3,(H,23,26)/t20-,21?/m0/s1 |
| InChIKey | SZZUKDVWRJJTHX-BGERDNNASA-N |
| XLogP | 3.95 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |