C20H29NO6 — CID 18633321
(3S)-5-methyl-2-(oxan-2-yloxy)-3-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 18633321) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is (3S)-5-methyl-2-(oxan-2-yloxy)-3-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (3S)-5-methyl-2-(oxan-2-yloxy)-3-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 18633321 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (3S)-5-methyl-2-(oxan-2-yloxy)-3-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C20H29NO6/c1-14(2)12-16(18(19(22)23)27-17-10-6-7-11-25-17)21-20(24)26-13-15-8-4-3-5-9-15/h3-5,8-9,14,16-18H,6-7,10-13H2,1-2H3,(H,21,24)(H,22,23)/t16-,17?,18?/m0/s1 |
| InChIKey | KPQUCYYSWUYHBX-AOCRQIFASA-N |
| XLogP | 3.32 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |