C22H27NO4 — CID 10499333
benzyl (2S,3S)-2-amino-2-methyl-3-(oxan-2-yloxy)-3-phenylpropanoate (PubChem CID 10499333) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is benzyl (2S,3S)-2-amino-2-methyl-3-(oxan-2-yloxy)-3-phenylpropanoate.
| Compound Name | benzyl (2S,3S)-2-amino-2-methyl-3-(oxan-2-yloxy)-3-phenylpropanoate |
|---|---|
| PubChem CID | 10499333 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | benzyl (2S,3S)-2-amino-2-methyl-3-(oxan-2-yloxy)-3-phenylpropanoate |
| SMILES | C[C@@](N)(C(=O)OCc1ccccc1)[C@@H](OC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO4/c1-22(23,21(24)26-16-17-10-4-2-5-11-17)20(18-12-6-3-7-13-18)27-19-14-8-9-15-25-19/h2-7,10-13,19-20H,8-9,14-16,23H2,1H3/t19?,20-,22-/m0/s1 |
| InChIKey | OBMLHPPQDYKZAE-BXBRYHBFSA-N |
| XLogP | 3.73 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |