C17H24O4 — CID 139682584
ethyl (2S)-2-[(2S)-oxan-2-yl]oxy-4-phenylbutanoate (PubChem CID 139682584) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl (2S)-2-[(2S)-oxan-2-yl]oxy-4-phenylbutanoate.
| Compound Name | ethyl (2S)-2-[(2S)-oxan-2-yl]oxy-4-phenylbutanoate |
|---|---|
| PubChem CID | 139682584 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | ethyl (2S)-2-[(2S)-oxan-2-yl]oxy-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)O[C@H]1CCCCO1 |
| InChI | InChI=1S/C17H24O4/c1-2-19-17(18)15(21-16-10-6-7-13-20-16)12-11-14-8-4-3-5-9-14/h3-5,8-9,15-16H,2,6-7,10-13H2,1H3/t15-,16-/m0/s1 |
| InChIKey | GONGRPPDFCSQFC-HOTGVXAUSA-N |
| XLogP | 3.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |