C10H15F3O4 — CID 22913388
ethyl 3,3,3-trifluoro-2-(oxan-2-yloxy)propanoate (PubChem CID 22913388) has the molecular formula C10H15F3O4 and a molecular weight of 256.22 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-(oxan-2-yloxy)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-(oxan-2-yloxy)propanoate |
|---|---|
| PubChem CID | 22913388 |
| Molecular Formula | C10H15F3O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-(oxan-2-yloxy)propanoate |
| SMILES | CCOC(=O)C(OC1CCCCO1)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O4/c1-2-15-9(14)8(10(11,12)13)17-7-5-3-4-6-16-7/h7-8H,2-6H2,1H3 |
| InChIKey | ZNNKMXNRORIPAE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |