About oxan-2-yl butanoate
oxan-2-yl butanoate (PubChem CID 14932559) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is oxan-2-yl butanoate.
Molecular Properties
| Compound Name | oxan-2-yl butanoate |
| PubChem CID | 14932559 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | oxan-2-yl butanoate |
| SMILES | CCCC(=O)OC1CCCCO1 |
| InChI | InChI=1S/C9H16O3/c1-2-5-8(10)12-9-6-3-4-7-11-9/h9H,2-7H2,1H3 |
| InChIKey | CRYWJBBDNFRLMC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxan-2-yl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-yl butanoate?
The IUPAC name of oxan-2-yl butanoate (CID 14932559) is oxan-2-yl butanoate.
What is the SMILES notation for oxan-2-yl butanoate?
The canonical SMILES for oxan-2-yl butanoate is CCCC(=O)OC1CCCCO1.
What is the InChIKey of oxan-2-yl butanoate?
The InChIKey is CRYWJBBDNFRLMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-2-5-8(10)12-9-6-3-4-7-11-9/h9H,2-7H2,1H3.
What are the key properties of oxan-2-yl butanoate?
oxan-2-yl butanoate has a molecular weight of 172.22 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-yl butanoate is sourced from PubChem (CID 14932559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).