About oxan-2-yl octanoate
oxan-2-yl octanoate (PubChem CID 23405562) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is oxan-2-yl octanoate.
Molecular Properties
| Compound Name | oxan-2-yl octanoate |
| PubChem CID | 23405562 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | oxan-2-yl octanoate |
| SMILES | CCCCCCCC(=O)OC1CCCCO1 |
| InChI | InChI=1S/C13H24O3/c1-2-3-4-5-6-9-12(14)16-13-10-7-8-11-15-13/h13H,2-11H2,1H3 |
| InChIKey | OKCHQWPRPYHLQJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze oxan-2-yl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-yl octanoate?
The IUPAC name of oxan-2-yl octanoate (CID 23405562) is oxan-2-yl octanoate.
What is the SMILES notation for oxan-2-yl octanoate?
The canonical SMILES for oxan-2-yl octanoate is CCCCCCCC(=O)OC1CCCCO1.
What is the InChIKey of oxan-2-yl octanoate?
The InChIKey is OKCHQWPRPYHLQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-2-3-4-5-6-9-12(14)16-13-10-7-8-11-15-13/h13H,2-11H2,1H3.
What are the key properties of oxan-2-yl octanoate?
oxan-2-yl octanoate has a molecular weight of 228.33 g/mol, XLogP of 3.42, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-yl octanoate is sourced from PubChem (CID 23405562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).