About 1-(oxan-2-yl)nonan-1-one
1-(oxan-2-yl)nonan-1-one (PubChem CID 114966896) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-(oxan-2-yl)nonan-1-one.
Molecular Properties
| Compound Name | 1-(oxan-2-yl)nonan-1-one |
| PubChem CID | 114966896 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 1-(oxan-2-yl)nonan-1-one |
| SMILES | CCCCCCCCC(=O)C1CCCCO1 |
| InChI | InChI=1S/C14H26O2/c1-2-3-4-5-6-7-10-13(15)14-11-8-9-12-16-14/h14H,2-12H2,1H3 |
| InChIKey | IZXCIVHDMHLDSE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(oxan-2-yl)nonan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-2-yl)nonan-1-one?
The IUPAC name of 1-(oxan-2-yl)nonan-1-one (CID 114966896) is 1-(oxan-2-yl)nonan-1-one.
What is the SMILES notation for 1-(oxan-2-yl)nonan-1-one?
The canonical SMILES for 1-(oxan-2-yl)nonan-1-one is CCCCCCCCC(=O)C1CCCCO1.
What is the InChIKey of 1-(oxan-2-yl)nonan-1-one?
The InChIKey is IZXCIVHDMHLDSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-2-3-4-5-6-7-10-13(15)14-11-8-9-12-16-14/h14H,2-12H2,1H3.
What are the key properties of 1-(oxan-2-yl)nonan-1-one?
1-(oxan-2-yl)nonan-1-one has a molecular weight of 226.36 g/mol, XLogP of 3.88, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-2-yl)nonan-1-one is sourced from PubChem (CID 114966896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).