C21H32O4 — CID 139931637
(5S)-4,4-dimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-one (PubChem CID 139931637) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (5S)-4,4-dimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-one.
| Compound Name | (5S)-4,4-dimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-one |
|---|---|
| PubChem CID | 139931637 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (5S)-4,4-dimethyl-5-(oxan-2-yloxy)-7-phenylmethoxyheptan-3-one |
| SMILES | CCC(=O)C(C)(C)[C@H](CCOCc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C21H32O4/c1-4-18(22)21(2,3)19(25-20-12-8-9-14-24-20)13-15-23-16-17-10-6-5-7-11-17/h5-7,10-11,19-20H,4,8-9,12-16H2,1-3H3/t19-,20?/m0/s1 |
| InChIKey | VYTWEILHILRIGP-XJDOXCRVSA-N |
| XLogP | 4.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|